Difference between revisions of "SJ13457"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1456-TETRAKISPHOSPHATE INOSITOL-1456-TETRAKISPHOSPHATE] == * common-name: ** d-myo-ino...")
(Created page with "Category:gene == Gene SJ21612 == * transcription-direction: ** negative * right-end-position: ** 37409 * left-end-position: ** 5959 * centisome-position: ** 3.1528268...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1456-TETRAKISPHOSPHATE INOSITOL-1456-TETRAKISPHOSPHATE] ==
+
== Gene SJ21612 ==
* common-name:
+
* transcription-direction:
** d-myo-inositol (1,4,5,6)-tetrakisphosphate
+
** negative
* smiles:
+
* right-end-position:
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
+
** 37409
* inchi-key:
+
* left-end-position:
** mrvyfoanpdtyby-yortwtkjsa-f
+
** 5959
* molecular-weight:
+
* centisome-position:
** 492.013
+
** 3.1528268   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-7162]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[2.7.1.151-RXN]]
+
* [[3.4.22.68-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=d-myo-inositol (1,4,5,6)-tetrakisphosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=mrvyfoanpdtyby-yortwtkjsa-f}}
+
** Category: [[orthology]]
{{#set: molecular-weight=492.013}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=37409}}
 +
{{#set: left-end-position=5959}}
 +
{{#set: centisome-position=3.1528268    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ21612

  • transcription-direction:
    • negative
  • right-end-position:
    • 37409
  • left-end-position:
    • 5959
  • centisome-position:
    • 3.1528268

Organism(s) associated with this gene

Reaction(s) associated