Difference between revisions of "SJ15366"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * common-name: ** acetophenone * smiles: ** cc(=o)c1(c=cc=cc=1) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] ==
 
* common-name:
 
* common-name:
** nω-phosphocreatine
+
** acetophenone
 
* smiles:
 
* smiles:
** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
+
** cc(=o)c1(c=cc=cc=1)
 
* inchi-key:
 
* inchi-key:
** drbbfclwyrjsjz-uhfffaoysa-l
+
** kwolfjpfchcocg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 209.098
+
** 120.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CREATINE-KINASE-RXN]]
+
* [[RXN-1302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CREATINE-KINASE-RXN]]
+
* [[RXN-1302]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nω-phosphocreatine}}
+
{{#set: common-name=acetophenone}}
{{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=kwolfjpfchcocg-uhfffaoysa-n}}
{{#set: molecular-weight=209.098}}
+
{{#set: molecular-weight=120.151}}

Revision as of 14:20, 26 August 2019

Metabolite PHENYL

  • common-name:
    • acetophenone
  • smiles:
    • cc(=o)c1(c=cc=cc=1)
  • inchi-key:
    • kwolfjpfchcocg-uhfffaoysa-n
  • molecular-weight:
    • 120.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality