Difference between revisions of "SJ21349"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * common-name: ** isofucosterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
 
* common-name:
 
* common-name:
** 6-hydroxymelatonin
+
** isofucosterol
 
* smiles:
 
* smiles:
** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2))
+
** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** omymrcxojjzyke-uhfffaoysa-n
+
** oselkochbmdkej-wgmizeqosa-n
 
* molecular-weight:
 
* molecular-weight:
** 248.281
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11058]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11056]]
+
* [[RXN-4210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-hydroxymelatonin}}
+
{{#set: common-name=isofucosterol}}
{{#set: inchi-key=inchikey=omymrcxojjzyke-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=oselkochbmdkej-wgmizeqosa-n}}
{{#set: molecular-weight=248.281}}
+
{{#set: molecular-weight=412.698}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-4127

  • common-name:
    • isofucosterol
  • smiles:
    • cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • oselkochbmdkej-wgmizeqosa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality