Difference between revisions of "SUC-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTHIOCYS-RXN CYSTHIOCYS-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expa...")
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTHIOCYS-RXN CYSTHIOCYS-RXN] ==
+
== Metabolite SUC-COA ==
* direction:
+
* common-name:
** left-to-right
+
** succinyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.4.1.35 ec-4.4.1.35]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CYSTINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[THIOCYSTEINE]][c]
+
** vnoyujkhfwywir-itiydsspsa-i
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ20026]]
+
** 862.568
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[AKGDHe2r]]
== Pathway(s) ==
+
* [[HOMSUCTRAN-RXN]]
== Reconstruction information  ==
+
* [[RXN0-1147]]
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[SUCCCOASYN-RXN]]
== External links  ==
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
* RHEA:
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24930 24930]
+
== Reaction(s) known to produce the compound ==
* LIGAND-RXN:
+
* [[2OXOGLUTARATEDEH-RXN]]
** [http://www.genome.jp/dbget-bin/www_bget?R02408 R02408]
+
* [[AKGDHe2r]]
{{#set: direction=left-to-right}}
+
* [[RXN0-1147]]
{{#set: ec-number=ec-4.4.1.35}}
+
* [[SUCCCOASYN-RXN]]
{{#set: nb gene associated=1}}
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
{{#set: nb pathway associated=0}}
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
{{#set: reconstruction category=orthology}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction tool=pantograph}}
+
{{#set: common-name=succinyl-coa}}
{{#set: reconstruction comment=n.a}}
+
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
+
{{#set: molecular-weight=862.568}}

Latest revision as of 11:15, 18 March 2021

Metabolite SUC-COA

  • common-name:
    • succinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vnoyujkhfwywir-itiydsspsa-i
  • molecular-weight:
    • 862.568

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality