Difference between revisions of "SUC-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8990 == * common-name: ** l-methionine-(r)-s-oxide * smiles: ** cs(=o)ccc([n+])c(=o)[o-] * inchi-key: ** qefrnwwlzkmpfj-zxpfjrlxsa-n...") |
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPDQT-39 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-[(6'-methylthio)hexyl]malate |
* smiles: | * smiles: | ||
− | ** | + | ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lqqzhlhcfscjcu-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 262.32 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-18202]] |
+ | * [[RXNQT-4174]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-18202]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-[(6'-methylthio)hexyl]malate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=262.32}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPDQT-39
- common-name:
- 3-[(6'-methylthio)hexyl]malate
- smiles:
- csccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- lqqzhlhcfscjcu-uhfffaoysa-l
- molecular-weight:
- 262.32
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(6'-methylthio)hexyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.