Difference between revisions of "SUC-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8990 == * common-name: ** l-methionine-(r)-s-oxide * smiles: ** cs(=o)ccc([n+])c(=o)[o-] * inchi-key: ** qefrnwwlzkmpfj-zxpfjrlxsa-n...")
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8990 ==
+
== Metabolite CPDQT-39 ==
 
* common-name:
 
* common-name:
** l-methionine-(r)-s-oxide
+
** 3-[(6'-methylthio)hexyl]malate
 
* smiles:
 
* smiles:
** cs(=o)ccc([n+])c(=o)[o-]
+
** csccccccc(c(o)c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** qefrnwwlzkmpfj-zxpfjrlxsa-n
+
** lqqzhlhcfscjcu-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 165.207
+
** 262.32
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.14-RXN]]
+
* [[RXN-18202]]
 +
* [[RXNQT-4174]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18202]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-methionine-(r)-s-oxide}}
+
{{#set: common-name=3-[(6'-methylthio)hexyl]malate}}
{{#set: inchi-key=inchikey=qefrnwwlzkmpfj-zxpfjrlxsa-n}}
+
{{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}}
{{#set: molecular-weight=165.207}}
+
{{#set: molecular-weight=262.32}}

Revision as of 13:11, 14 January 2021

Metabolite CPDQT-39

  • common-name:
    • 3-[(6'-methylthio)hexyl]malate
  • smiles:
    • csccccccc(c(o)c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • lqqzhlhcfscjcu-uhfffaoysa-l
  • molecular-weight:
    • 262.32

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "3-[(6'-methylthio)hexyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.