Difference between revisions of "SUC-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9545 RXN-9545] == * direction: ** left-to-right * common-name: ** 3-hydroxystearoyl-dehydratase...")
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9545 RXN-9545] ==
+
== Metabolite SUC-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-hydroxystearoyl-dehydratase
+
** succinyl-coa
−
** 3-hydroxyacyl-coa dehydrase
+
* smiles:
−
* ec-number:
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
** [http://enzyme.expasy.org/EC/4.2.1.119 ec-4.2.1.119]
+
* inchi-key:
−
== Reaction formula ==
+
** vnoyujkhfwywir-itiydsspsa-i
−
* 1 [[CPD-10261]][c] '''=>''' 1 [[CPD-10262]][c] '''+''' 1 [[WATER]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 862.568
−
* Gene: [[SJ03584]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[AKGDHe2r]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[HOMSUCTRAN-RXN]]
−
* Gene: [[SJ04769]]
+
* [[RXN0-1147]]
−
** Category: [[annotation]]
+
* [[SUCCCOASYN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
−
== Pathway(s) ==
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
−
* [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972]
+
== Reaction(s) known to produce the compound ==
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
* [[2OXOGLUTARATEDEH-RXN]]
−
== Reconstruction information  ==
+
* [[AKGDHe2r]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN0-1147]]
−
== External links  ==
+
* [[SUCCCOASYN-RXN]]
−
* LIGAND-RXN:
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R07760 R07760]
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-hydroxyacyl-coa dehydrase|3-hydroxystearoyl-dehydratase}}
+
{{#set: common-name=succinyl-coa}}
−
{{#set: ec-number=ec-4.2.1.119}}
+
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
−
{{#set: nb gene associated=2}}
+
{{#set: molecular-weight=862.568}}
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite SUC-COA

  • common-name:
    • succinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vnoyujkhfwywir-itiydsspsa-i
  • molecular-weight:
    • 862.568

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SUC-COA&oldid=138508"