Difference between revisions of "THREONINE-DEG2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfamates Sulfamates] == * common-name: ** a sulfamate == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] == * common-name: ** kaempferol-3-glucoside * smiles: ** c1(c=c(o)c=cc=1c3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfamates Sulfamates] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] ==
 
* common-name:
 
* common-name:
** a sulfamate
+
** kaempferol-3-glucoside
 +
* smiles:
 +
** c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
 +
* inchi-key:
 +
** jpukweqwgbddqb-qsofnflrsa-m
 +
* molecular-weight:
 +
** 447.374
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
+
* [[RXN1F-461]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sulfamate}}
+
{{#set: common-name=kaempferol-3-glucoside}}
 +
{{#set: inchi-key=inchikey=jpukweqwgbddqb-qsofnflrsa-m}}
 +
{{#set: molecular-weight=447.374}}

Revision as of 09:22, 27 August 2019

Metabolite CPD1F-453

  • common-name:
    • kaempferol-3-glucoside
  • smiles:
    • c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
  • inchi-key:
    • jpukweqwgbddqb-qsofnflrsa-m
  • molecular-weight:
    • 447.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality