Difference between revisions of "THREONINE-DEG2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] == * common-name: ** kaempferol-3-glucoside * smiles: ** c1(c=c(o)c=cc=1c3...")
(Created page with "Category:pathway == Pathway PWY-6184 == * taxonomic-range: ** tax-2 * common-name: ** methylsalicylate degradation == Reaction(s) found == * RXN-10078 * RXN-10079...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] ==
+
== Pathway PWY-6184 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** kaempferol-3-glucoside
+
** methylsalicylate degradation
* smiles:
+
== Reaction(s) found ==
** c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
+
* [[RXN-10078]]
* inchi-key:
+
* [[RXN-10079]]
** jpukweqwgbddqb-qsofnflrsa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 447.374
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=methylsalicylate degradation}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[RXN1F-461]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=2}}
{{#set: common-name=kaempferol-3-glucoside}}
 
{{#set: inchi-key=inchikey=jpukweqwgbddqb-qsofnflrsa-m}}
 
{{#set: molecular-weight=447.374}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6184

  • taxonomic-range:
    • tax-2
  • common-name:
    • methylsalicylate degradation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present