Difference between revisions of "TRNA-pseudouridine32"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...")
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine == * common-name: ** an n-terminal l-cysteinyl-[protein] == Reaction(s) known to consume the compound == == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CDP ==
+
== Metabolite N-terminal-L-cysteine ==
 
* common-name:
 
* common-name:
** cdp
+
** an n-terminal l-cysteinyl-[protein]
* smiles:
 
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
 
* inchi-key:
 
** zwiadyzpowuwew-xvfcmesisa-k
 
* molecular-weight:
 
** 400.155
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATCD]]
 
* [[ATCDm]]
 
* [[CDPKIN-RXN]]
 
* [[CDPREDUCT-RXN]]
 
* [[DCDT]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 
* [[RXN-12198]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATCM]]
+
* [[RXN-17874]]
* [[DOLICHOL-KINASE-RXN]]
 
* [[RXN-11832]]
 
* [[RXN-12195]]
 
* [[RXN-12959]]
 
* [[RXN-15091]]
 
* [[RXN-7683]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cdp}}
+
{{#set: common-name=an n-terminal l-cysteinyl-[protein]}}
{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
 
{{#set: molecular-weight=400.155}}
 

Revision as of 14:56, 5 January 2021

Metabolite N-terminal-L-cysteine

  • common-name:
    • an n-terminal l-cysteinyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-cysteinyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.