Difference between revisions of "TRNA-pseudouridine32"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite cis-D19-37-MOH-38-Me-C57-1-ACPs == * common-name: ** a cis-delta19-37-methoxy-38-methyl-c57:1-[acp] == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite GALACTOSE == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-fprjbgldsa-n * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite cis-D19-37-MOH-38-Me-C57-1-ACPs ==
+
== Metabolite GALACTOSE ==
 
* common-name:
 
* common-name:
** a cis-delta19-37-methoxy-38-methyl-c57:1-[acp]
+
** β-d-galactose
 +
* smiles:
 +
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** wqzgkkkjijffok-fprjbgldsa-n
 +
* molecular-weight:
 +
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-2544]]
+
* [[ALDOSE1EPIM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALDOSE1EPIM-RXN]]
 +
* [[BETAGALACTOSID-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cis-delta19-37-methoxy-38-methyl-c57:1-[acp]}}
+
{{#set: common-name=β-d-galactose}}
 +
{{#set: inchi-key=inchikey=wqzgkkkjijffok-fprjbgldsa-n}}
 +
{{#set: molecular-weight=180.157}}

Revision as of 18:55, 14 January 2021

Metabolite GALACTOSE

  • common-name:
    • β-d-galactose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-fprjbgldsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality