Difference between revisions of "TRNA-uridine-38-40"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15361 == * common-name: ** 3r-hydroxy-(11z)-eicos-11-enoyl-coa * smiles: ** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)c...")
(Created page with "Category:metabolite == Metabolite tRNA-uridine-38-40 == * common-name: ** a uridine38-40 in trna == Reaction(s) known to consume the compound == * TRNA-PSEUDOURIDINE-SYN...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15361 ==
+
== Metabolite tRNA-uridine-38-40 ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-(11z)-eicos-11-enoyl-coa
+
** a uridine38-40 in trna
* smiles:
 
** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** preomqknjxwclz-zhlmiuqrsa-j
 
* molecular-weight:
 
** 1072.006
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14485]]
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14484]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-(11z)-eicos-11-enoyl-coa}}
+
{{#set: common-name=a uridine38-40 in trna}}
{{#set: inchi-key=inchikey=preomqknjxwclz-zhlmiuqrsa-j}}
 
{{#set: molecular-weight=1072.006}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite tRNA-uridine-38-40

  • common-name:
    • a uridine38-40 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality