Difference between revisions of "Uridine32-in-tRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18494 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)...")
(Created page with "Category:metabolite == Metabolite Uridine32-in-tRNA == * common-name: ** a uridine32 in trna == Reaction(s) known to consume the compound == * RXN-11842 == Reaction(s)...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18494 ==
+
== Metabolite Uridine32-in-tRNA ==
 
* common-name:
 
* common-name:
** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+
** a uridine32 in trna
* smiles:
 
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** uiagujimvqpsdp-qojzhlsosa-j
 
* molecular-weight:
 
** 1118.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17116]]
+
* [[RXN-11842]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+
{{#set: common-name=a uridine32 in trna}}
{{#set: inchi-key=inchikey=uiagujimvqpsdp-qojzhlsosa-j}}
 
{{#set: molecular-weight=1118.034}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Uridine32-in-tRNA

  • common-name:
    • a uridine32 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality