Difference between revisions of "XANTHOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ILE-tRNAs == * common-name: ** a trnaile == Reaction(s) known to consume the compound == * ISOLEUCINE--TRNA-LIGASE-RXN == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ILE-tRNAs ==
+
== Metabolite XANTHOSINE ==
 
* common-name:
 
* common-name:
** a trnaile
+
** xanthosine
 +
* smiles:
 +
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 +
* inchi-key:
 +
** ubortcndukbeop-uuokfmhzsa-n
 +
* molecular-weight:
 +
** 284.228
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
+
* [[RXN0-363]]
 +
* [[XANTHOSINEPHOSPHORY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[X5NT]]
 +
* [[XMPXAN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnaile}}
+
{{#set: common-name=xanthosine}}
 +
{{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}}
 +
{{#set: molecular-weight=284.228}}

Latest revision as of 11:10, 18 March 2021

Metabolite XANTHOSINE

  • common-name:
    • xanthosine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
  • inchi-key:
    • ubortcndukbeop-uuokfmhzsa-n
  • molecular-weight:
    • 284.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality