Difference between revisions of "XANTHOSINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00560 == * transcription-direction: ** positive * right-end-position: ** 120184 * left-end-position: ** 119744 * centisome-position: ** 72.38567...") |
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite XANTHOSINE == |
| − | * | + | * common-name: |
| − | ** | + | ** xanthosine |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ubortcndukbeop-uuokfmhzsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 284.228 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-363]] |
| − | == Reaction(s) | + | * [[XANTHOSINEPHOSPHORY-RXN]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[X5NT]] |
| − | + | * [[XMPXAN-RXN]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=xanthosine}} |
| − | + | {{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=284.228}} |
| − | |||
| − | |||
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite XANTHOSINE
- common-name:
- xanthosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- ubortcndukbeop-uuokfmhzsa-n
- molecular-weight:
- 284.228
