Difference between revisions of "XANTHOSINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08358 == * transcription-direction: ** negative * right-end-position: ** 49147 * left-end-position: ** 33091 * centisome-position: ** 60.648434...") |
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
||
(9 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite XANTHOSINE == |
− | * | + | * common-name: |
− | ** | + | ** xanthosine |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** ubortcndukbeop-uuokfmhzsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 284.228 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-363]] |
− | == Reaction(s) | + | * [[XANTHOSINEPHOSPHORY-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[X5NT]] | |
− | * | + | * [[XMPXAN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=xanthosine}} | |
− | + | {{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=284.228}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite XANTHOSINE
- common-name:
- xanthosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- ubortcndukbeop-uuokfmhzsa-n
- molecular-weight:
- 284.228