Difference between revisions of "XANTHOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-710 == * common-name: ** campestanol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite XANTHOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** xanthosine |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ubortcndukbeop-uuokfmhzsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 284.228 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[RXN0-363]] |
+ | * [[XANTHOSINEPHOSPHORY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[X5NT]] | ||
+ | * [[XMPXAN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=xanthosine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=284.228}} |
Revision as of 18:52, 14 January 2021
Contents
Metabolite XANTHOSINE
- common-name:
- xanthosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- ubortcndukbeop-uuokfmhzsa-n
- molecular-weight:
- 284.228