Difference between revisions of "XANTHOSINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...")
(Created page with "Category:metabolite == Metabolite 4-TOLUENECARBOXYLATE == * common-name: ** 4-toluenecarboxylate * smiles: ** cc1(c=cc(=cc=1)c(=o)[o-]) * inchi-key: ** lpnbbfkouusudb-uhff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-DIHYDROXY-PHENYLALANINE ==
+
== Metabolite 4-TOLUENECARBOXYLATE ==
 
* common-name:
 
* common-name:
** l-dopa
+
** 4-toluenecarboxylate
 
* smiles:
 
* smiles:
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
+
** cc1(c=cc(=cc=1)c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** wtdrdqbearuvnc-lurjtmiesa-n
+
** lpnbbfkouusudb-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 197.19
+
** 135.142
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13061]]
 
* [[RXN-8460]]
 
* [[RXN66-221]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5861]]
+
* [[RXN-8582]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dopa}}
+
{{#set: common-name=4-toluenecarboxylate}}
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
+
{{#set: inchi-key=inchikey=lpnbbfkouusudb-uhfffaoysa-m}}
{{#set: molecular-weight=197.19}}
+
{{#set: molecular-weight=135.142}}

Revision as of 11:19, 15 January 2021

Metabolite 4-TOLUENECARBOXYLATE

  • common-name:
    • 4-toluenecarboxylate
  • smiles:
    • cc1(c=cc(=cc=1)c(=o)[o-])
  • inchi-key:
    • lpnbbfkouusudb-uhfffaoysa-m
  • molecular-weight:
    • 135.142

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality