Difference between revisions of "XANTHOSINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYL-HOMO-CYS == * common-name: ** s-adenosyl-l-homocysteine * smiles: ** c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)...")
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key:...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSYL-HOMO-CYS ==
+
== Metabolite XANTHOSINE-5-PHOSPHATE ==
 
* common-name:
 
* common-name:
** s-adenosyl-l-homocysteine
+
** xmp
 
* smiles:
 
* smiles:
** c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)[n+]
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 
* inchi-key:
 
* inchi-key:
** zjuktbdsgofhsh-wfmpwkqpsa-n
+
** dctlyfzhfgencw-uuokfmhzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 384.409
+
** 362.192
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.135-RXN]]
+
* [[GMP-SYN-GLUT-RXN]]
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
* [[GMP-SYN-NH3-RXN]]
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
+
* [[IMP-DEHYDROG-RXN]]
* [[AMETt2h]]
+
* [[X5NT]]
* [[AMETt2m]]
+
* [[XMPXAN-RXN]]
* [[RXN-17120]]
+
* [[XPPRT]]
* [[RXN-17121]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[IMP-DEHYDROG-RXN]]
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
+
* [[NTPD]]
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
+
* [[RXN0-1603]]
* [[2.1.1.100-RXN]]
+
* [[XPPRT]]
* [[2.1.1.113-RXN]]
 
* [[2.1.1.114-RXN]]
 
* [[2.1.1.115-RXN]]
 
* [[2.1.1.124-RXN]]
 
* [[2.1.1.125-RXN]]
 
* [[2.1.1.126-RXN]]
 
* [[2.1.1.127-RXN]]
 
* [[2.1.1.128-RXN]]
 
* [[2.1.1.137-RXN]]
 
* [[2.1.1.138-RXN]]
 
* [[2.1.1.140-RXN]]
 
* [[2.1.1.143-RXN]]
 
* [[2.1.1.17-RXN]]
 
* [[2.1.1.34-RXN]]
 
* [[2.1.1.57-RXN]]
 
* [[2.1.1.62-RXN]]
 
* [[2.1.1.64-RXN]]
 
* [[2.1.1.71-RXN]]
 
* [[2.1.1.72-RXN]]
 
* [[2.1.1.77-RXN]]
 
* [[2.1.1.79-RXN]]
 
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
 
* [[AMETt2h]]
 
* [[AMETt2m]]
 
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
 
* [[DHHB-METHYLTRANSFER-RXN]]
 
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
 
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
 
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
 
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
 
* [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
 
* [[RXN-1104]]
 
* [[RXN-11046]]
 
* [[RXN-11241]]
 
* [[RXN-11267]]
 
* [[RXN-11268]]
 
* [[RXN-11370]]
 
* [[RXN-11373]]
 
* [[RXN-11374]]
 
* [[RXN-1143]]
 
* [[RXN-11475]]
 
* [[RXN-11574]]
 
* [[RXN-11578]]
 
* [[RXN-11586]]
 
* [[RXN-11592]]
 
* [[RXN-11596]]
 
* [[RXN-11598]]
 
* [[RXN-11601]]
 
* [[RXN-11602]]
 
* [[RXN-11633]]
 
* [[RXN-11634]]
 
* [[RXN-11637]]
 
* [[RXN-11638]]
 
* [[RXN-11754]]
 
* [[RXN-11757]]
 
* [[RXN-11758]]
 
* [[RXN-11855]]
 
* [[RXN-11856]]
 
* [[RXN-11860]]
 
* [[RXN-11865]]
 
* [[RXN-11866]]
 
* [[RXN-11868]]
 
* [[RXN-12160]]
 
* [[RXN-12374]]
 
* [[RXN-12375]]
 
* [[RXN-12376]]
 
* [[RXN-12377]]
 
* [[RXN-12378]]
 
* [[RXN-12379]]
 
* [[RXN-12380]]
 
* [[RXN-12381]]
 
* [[RXN-12382]]
 
* [[RXN-12458]]
 
* [[RXN-12459]]
 
* [[RXN-12461]]
 
* [[RXN-12466]]
 
* [[RXN-12469]]
 
* [[RXN-12477]]
 
* [[RXN-12478]]
 
* [[RXN-12479]]
 
* [[RXN-12889]]
 
* [[RXN-12890]]
 
* [[RXN-13224]]
 
* [[RXN-13225]]
 
* [[RXN-13226]]
 
* [[RXN-13227]]
 
* [[RXN-13228]]
 
* [[RXN-13327]]
 
* [[RXN-13403]]
 
* [[RXN-13404]]
 
* [[RXN-13405]]
 
* [[RXN-13406]]
 
* [[RXN-13588]]
 
* [[RXN-13725]]
 
* [[RXN-13726]]
 
* [[RXN-13727]]
 
* [[RXN-13935]]
 
* [[RXN-14177]]
 
* [[RXN-14326]]
 
* [[RXN-14481]]
 
* [[RXN-14517]]
 
* [[RXN-14520]]
 
* [[RXN-14528]]
 
* [[RXN-14539]]
 
* [[RXN-14540]]
 
* [[RXN-14549]]
 
* [[RXN-14550]]
 
* [[RXN-14917]]
 
* [[RXN-14918]]
 
* [[RXN-14919]]
 
* [[RXN-14992]]
 
* [[RXN-15775]]
 
* [[RXN-15842]]
 
* [[RXN-15843]]
 
* [[RXN-15844]]
 
* [[RXN-16889]]
 
* [[RXN-16891]]
 
* [[RXN-16892]]
 
* [[RXN-17120]]
 
* [[RXN-17121]]
 
* [[RXN-2542]]
 
* [[RXN-2562]]
 
* [[RXN-2762]]
 
* [[RXN-3422]]
 
* [[RXN-4021]]
 
* [[RXN-5141]]
 
* [[RXN-7421]]
 
* [[RXN-8675]]
 
* [[RXN-9191]]
 
* [[RXN-9205]]
 
* [[RXN-9220]]
 
* [[RXN-9225]]
 
* [[RXN-9227]]
 
* [[RXN-9229]]
 
* [[RXN-9233]]
 
* [[RXN-9235]]
 
* [[RXN-9237]]
 
* [[RXN-9240]]
 
* [[RXN-9242]]
 
* [[RXN-9280]]
 
* [[RXN-9281]]
 
* [[RXN-9282]]
 
* [[RXN-9287]]
 
* [[RXN-9361]]
 
* [[RXN-9362]]
 
* [[RXN-9363]]
 
* [[RXN-9366]]
 
* [[RXN-9679]]
 
* [[RXN-9680]]
 
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 
* [[RXN0-5063]]
 
* [[RXN0-5144]]
 
* [[RXN0-5419]]
 
* [[RXN0-6731]]
 
* [[RXN0-6950]]
 
* [[RXN1G-2544]]
 
* [[RXN1G-3641]]
 
* [[RXN3O-102]]
 
* [[RXN3O-178]]
 
* [[RXN3O-54]]
 
* [[RXN4FS-2]]
 
* [[THIOL-S-METHYLTRANSFERASE-RXN]]
 
* [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
 
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
 
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
 
* [[UROPORIIIMETHYLTRANSA-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-adenosyl-l-homocysteine}}
+
{{#set: common-name=xmp}}
{{#set: inchi-key=inchikey=zjuktbdsgofhsh-wfmpwkqpsa-n}}
+
{{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}}
{{#set: molecular-weight=384.409}}
+
{{#set: molecular-weight=362.192}}

Latest revision as of 11:17, 18 March 2021

Metabolite XANTHOSINE-5-PHOSPHATE

  • common-name:
    • xmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
  • inchi-key:
    • dctlyfzhfgencw-uuokfmhzsa-l
  • molecular-weight:
    • 362.192

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality