|
|
| Line 1: |
Line 1: |
| | [[Category:metabolite]] | | [[Category:metabolite]] |
| − | == Metabolite ADENOSYL-HOMO-CYS == | + | == Metabolite CPD-690 == |
| | * common-name: | | * common-name: |
| − | ** s-adenosyl-l-homocysteine | + | ** adenosyl-cobyrinate a,c-diamide |
| | * smiles: | | * smiles: |
| − | ** c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)[n+] | + | ** cc5(=c%10(c(c)(ccc([o-])=o)c(cc(=o)[o-])c9(c%11(c)(c(c)(cc(n)=o)c(ccc([o-])=o)c1(=[n+]([co--]3([n+]2(c(=c(c)1)c(c)(cc(n)=o)c(ccc([o-])=o)c=2c=c4(c(c)(c)c(ccc([o-])=o)c(=[n+]34)5)))(cc6(c(c(o)c(o6)n7(c=nc8(=c7n=cn=c8n)))o))n9%10)%11))))) |
| | * inchi-key: | | * inchi-key: |
| − | ** zjuktbdsgofhsh-wfmpwkqpsa-n | + | ** ocnljczkghkjgf-nqyrmhkhsa-h |
| | * molecular-weight: | | * molecular-weight: |
| − | ** 384.409 | + | ** 1182.137 |
| | == Reaction(s) known to consume the compound == | | == Reaction(s) known to consume the compound == |
| − | * [[2.1.1.135-RXN]]
| |
| − | * [[ADENOSYLHOMOCYSTEINASE-RXN]]
| |
| − | * [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
| |
| − | * [[AMETt2h]]
| |
| − | * [[AMETt2m]]
| |
| − | * [[RXN-17120]]
| |
| − | * [[RXN-17121]]
| |
| | == Reaction(s) known to produce the compound == | | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[R344-RXN]] |
| − | * [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
| |
| − | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
| |
| − | * [[2.1.1.100-RXN]]
| |
| − | * [[2.1.1.113-RXN]]
| |
| − | * [[2.1.1.114-RXN]]
| |
| − | * [[2.1.1.115-RXN]]
| |
| − | * [[2.1.1.124-RXN]]
| |
| − | * [[2.1.1.125-RXN]]
| |
| − | * [[2.1.1.126-RXN]]
| |
| − | * [[2.1.1.127-RXN]]
| |
| − | * [[2.1.1.128-RXN]]
| |
| − | * [[2.1.1.137-RXN]]
| |
| − | * [[2.1.1.138-RXN]]
| |
| − | * [[2.1.1.140-RXN]]
| |
| − | * [[2.1.1.143-RXN]]
| |
| − | * [[2.1.1.17-RXN]]
| |
| − | * [[2.1.1.34-RXN]]
| |
| − | * [[2.1.1.57-RXN]]
| |
| − | * [[2.1.1.62-RXN]]
| |
| − | * [[2.1.1.64-RXN]]
| |
| − | * [[2.1.1.71-RXN]]
| |
| − | * [[2.1.1.72-RXN]]
| |
| − | * [[2.1.1.77-RXN]]
| |
| − | * [[2.1.1.79-RXN]]
| |
| − | * [[ADENOSYLHOMOCYSTEINASE-RXN]]
| |
| − | * [[ADOMET-DMK-METHYLTRANSFER-RXN]]
| |
| − | * [[AMETt2h]]
| |
| − | * [[AMETt2m]]
| |
| − | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
| |
| − | * [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
| |
| − | * [[DHHB-METHYLTRANSFER-RXN]]
| |
| − | * [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
| |
| − | * [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
| |
| − | * [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
| |
| − | * [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
| |
| − | * [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
| |
| − | * [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
| |
| − | * [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
| |
| − | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
| |
| − | * [[RXN-1104]]
| |
| − | * [[RXN-11046]]
| |
| − | * [[RXN-11241]]
| |
| − | * [[RXN-11267]]
| |
| − | * [[RXN-11268]]
| |
| − | * [[RXN-11370]]
| |
| − | * [[RXN-11373]]
| |
| − | * [[RXN-11374]]
| |
| − | * [[RXN-1143]]
| |
| − | * [[RXN-11475]]
| |
| − | * [[RXN-11574]]
| |
| − | * [[RXN-11578]]
| |
| − | * [[RXN-11586]]
| |
| − | * [[RXN-11592]]
| |
| − | * [[RXN-11596]]
| |
| − | * [[RXN-11598]]
| |
| − | * [[RXN-11601]]
| |
| − | * [[RXN-11602]]
| |
| − | * [[RXN-11633]]
| |
| − | * [[RXN-11634]]
| |
| − | * [[RXN-11637]]
| |
| − | * [[RXN-11638]]
| |
| − | * [[RXN-11754]]
| |
| − | * [[RXN-11757]]
| |
| − | * [[RXN-11758]]
| |
| − | * [[RXN-11855]]
| |
| − | * [[RXN-11856]]
| |
| − | * [[RXN-11860]]
| |
| − | * [[RXN-11865]]
| |
| − | * [[RXN-11866]]
| |
| − | * [[RXN-11868]]
| |
| − | * [[RXN-12160]]
| |
| − | * [[RXN-12374]]
| |
| − | * [[RXN-12375]]
| |
| − | * [[RXN-12376]]
| |
| − | * [[RXN-12377]]
| |
| − | * [[RXN-12378]]
| |
| − | * [[RXN-12379]]
| |
| − | * [[RXN-12380]]
| |
| − | * [[RXN-12381]]
| |
| − | * [[RXN-12382]]
| |
| − | * [[RXN-12458]]
| |
| − | * [[RXN-12459]]
| |
| − | * [[RXN-12461]]
| |
| − | * [[RXN-12466]]
| |
| − | * [[RXN-12469]]
| |
| − | * [[RXN-12477]]
| |
| − | * [[RXN-12478]]
| |
| − | * [[RXN-12479]]
| |
| − | * [[RXN-12889]]
| |
| − | * [[RXN-12890]]
| |
| − | * [[RXN-13224]]
| |
| − | * [[RXN-13225]]
| |
| − | * [[RXN-13226]]
| |
| − | * [[RXN-13227]]
| |
| − | * [[RXN-13228]]
| |
| − | * [[RXN-13327]]
| |
| − | * [[RXN-13403]]
| |
| − | * [[RXN-13404]]
| |
| − | * [[RXN-13405]]
| |
| − | * [[RXN-13406]]
| |
| − | * [[RXN-13588]]
| |
| − | * [[RXN-13725]]
| |
| − | * [[RXN-13726]]
| |
| − | * [[RXN-13727]]
| |
| − | * [[RXN-13935]]
| |
| − | * [[RXN-14177]]
| |
| − | * [[RXN-14326]]
| |
| − | * [[RXN-14481]]
| |
| − | * [[RXN-14517]]
| |
| − | * [[RXN-14520]]
| |
| − | * [[RXN-14528]]
| |
| − | * [[RXN-14539]]
| |
| − | * [[RXN-14540]]
| |
| − | * [[RXN-14549]]
| |
| − | * [[RXN-14550]]
| |
| − | * [[RXN-14917]]
| |
| − | * [[RXN-14918]]
| |
| − | * [[RXN-14919]]
| |
| − | * [[RXN-14992]]
| |
| − | * [[RXN-15775]]
| |
| − | * [[RXN-15842]]
| |
| − | * [[RXN-15843]]
| |
| − | * [[RXN-15844]]
| |
| − | * [[RXN-16889]]
| |
| − | * [[RXN-16891]]
| |
| − | * [[RXN-16892]]
| |
| − | * [[RXN-17120]]
| |
| − | * [[RXN-17121]]
| |
| − | * [[RXN-2542]]
| |
| − | * [[RXN-2562]]
| |
| − | * [[RXN-2762]]
| |
| − | * [[RXN-3422]]
| |
| − | * [[RXN-4021]]
| |
| − | * [[RXN-5141]]
| |
| − | * [[RXN-7421]]
| |
| − | * [[RXN-8675]]
| |
| − | * [[RXN-9191]]
| |
| − | * [[RXN-9205]]
| |
| − | * [[RXN-9220]]
| |
| − | * [[RXN-9225]]
| |
| − | * [[RXN-9227]]
| |
| − | * [[RXN-9229]]
| |
| − | * [[RXN-9233]]
| |
| − | * [[RXN-9235]]
| |
| − | * [[RXN-9237]]
| |
| − | * [[RXN-9240]]
| |
| − | * [[RXN-9242]]
| |
| − | * [[RXN-9280]]
| |
| − | * [[RXN-9281]]
| |
| − | * [[RXN-9282]]
| |
| − | * [[RXN-9287]]
| |
| − | * [[RXN-9361]]
| |
| − | * [[RXN-9362]]
| |
| − | * [[RXN-9363]]
| |
| − | * [[RXN-9366]]
| |
| − | * [[RXN-9679]]
| |
| − | * [[RXN-9680]]
| |
| − | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
| |
| − | * [[RXN0-5063]]
| |
| − | * [[RXN0-5144]]
| |
| − | * [[RXN0-5419]]
| |
| − | * [[RXN0-6731]]
| |
| − | * [[RXN0-6950]]
| |
| − | * [[RXN1G-2544]]
| |
| − | * [[RXN1G-3641]]
| |
| − | * [[RXN3O-102]]
| |
| − | * [[RXN3O-178]]
| |
| − | * [[RXN3O-54]]
| |
| − | * [[RXN4FS-2]]
| |
| − | * [[THIOL-S-METHYLTRANSFERASE-RXN]]
| |
| − | * [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
| |
| − | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
| |
| − | * [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
| |
| − | * [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
| |
| − | * [[UROPORIIIMETHYLTRANSA-RXN]] | |
| − | </div>
| |
| | == Reaction(s) of unknown directionality == | | == Reaction(s) of unknown directionality == |
| − | {{#set: common-name=s-adenosyl-l-homocysteine}} | + | {{#set: common-name=adenosyl-cobyrinate a,c-diamide}} |
| − | {{#set: inchi-key=inchikey=zjuktbdsgofhsh-wfmpwkqpsa-n}} | + | {{#set: inchi-key=inchikey=ocnljczkghkjgf-nqyrmhkhsa-h}} |
| − | {{#set: molecular-weight=384.409}} | + | {{#set: molecular-weight=1182.137}} |
