Difference between revisions of "ZN+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7031 == * common-name: ** 3-methylbutanal * smiles: ** cc(c)c[ch]=o * inchi-key: ** yghrjjrrzdovpd-uhfffaoysa-n * molecular-weight: *...")
(Created page with "Category:metabolite == Metabolite CPD-1825 == * common-name: ** β-l-arabinose 1-phosphate * smiles: ** c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-]) * inchi-key: ** ilxhfxfppzg...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7031 ==
+
== Metabolite CPD-1825 ==
 
* common-name:
 
* common-name:
** 3-methylbutanal
+
** β-l-arabinose 1-phosphate
 
* smiles:
 
* smiles:
** cc(c)c[ch]=o
+
** c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** yghrjjrrzdovpd-uhfffaoysa-n
+
** ilxhfxfppzgenn-qmkxcqhvsa-l
 
* molecular-weight:
 
* molecular-weight:
** 86.133
+
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7693]]
+
* [[UMPU]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7693]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylbutanal}}
+
{{#set: common-name=β-l-arabinose 1-phosphate}}
{{#set: inchi-key=inchikey=yghrjjrrzdovpd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=ilxhfxfppzgenn-qmkxcqhvsa-l}}
{{#set: molecular-weight=86.133}}
+
{{#set: molecular-weight=228.095}}

Revision as of 11:13, 15 January 2021

Metabolite CPD-1825

  • common-name:
    • β-l-arabinose 1-phosphate
  • smiles:
    • c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-])
  • inchi-key:
    • ilxhfxfppzgenn-qmkxcqhvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality