Difference between revisions of "ZN+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06720 == * transcription-direction: ** positive * right-end-position: ** 29534 * left-end-position: ** 27245 * centisome-position: ** 5.772319...")
(Created page with "Category:metabolite == Metabolite D-GLT == * common-name: ** d-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inchi-key: ** whuutdbjxjrkmk-gsvougtgsa-m * molecular...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06720 ==
+
== Metabolite D-GLT ==
* transcription-direction:
+
* common-name:
** positive
+
** d-glutamate
* right-end-position:
+
* smiles:
** 29534
+
** c(ccc(c(=o)[o-])[n+])([o-])=o
* left-end-position:
+
* inchi-key:
** 27245
+
** whuutdbjxjrkmk-gsvougtgsa-m
* centisome-position:
+
* molecular-weight:
** 5.772319   
+
** 146.122
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[5.3.4.1-RXN]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=d-glutamate}}
* [[DISULISOM-RXN]]
+
{{#set: inchi-key=inchikey=whuutdbjxjrkmk-gsvougtgsa-m}}
** Category: [[annotation]]
+
{{#set: molecular-weight=146.122}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=29534}}
 
{{#set: left-end-position=27245}}
 
{{#set: centisome-position=5.772319    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Revision as of 20:30, 18 December 2020

Metabolite D-GLT

  • common-name:
    • d-glutamate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])([o-])=o
  • inchi-key:
    • whuutdbjxjrkmk-gsvougtgsa-m
  • molecular-weight:
    • 146.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality