Difference between revisions of "APS"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE] == * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == * common name: ** adenosine 5'-phosphosulfate * inchi key: ** InChIKey=IRLPACMLTUPB...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == |
* common name: | * common name: | ||
| − | ** | + | ** adenosine 5'-phosphosulfate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 425.266 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** adenylyl-sulfate |
| − | ** | + | ** APS |
| − | ** | + | ** adenosine phosphosulfate |
| − | ** | + | ** adenosine 5'-sulphatophosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.8.4.9-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN | + | * [[ADENYLYLSULFKIN-RXN]] |
| − | * [[ | + | * [[SULFATE-ADENYLYLTRANS-RXN]] |
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852317 49852317] |
| + | * METABOLIGHTS : MTBLC58243 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00224 C00224] |
| − | * | + | * CAS : 485-84-7 |
| − | + | * BIGG : aps | |
| − | * BIGG : | + | * HMDB : HMDB01003 |
| − | * HMDB : | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58243 58243] |
| − | {{#set: common name= | + | {{#set: common name=adenosine 5'-phosphosulfate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L}} |
| − | {{#set: smiles= | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=425.266 }} |
| − | {{#set: common name= | + | {{#set: common name=adenylyl-sulfate|APS|adenosine phosphosulfate|adenosine 5'-sulphatophosphate}} |
| − | {{#set: consumed by=RXN | + | {{#set: consumed by=1.8.4.9-RXN}} |
| − | {{#set: reversible reaction associated=RXN | + | {{#set: reversible reaction associated=ADENYLYLSULFKIN-RXN|SULFATE-ADENYLYLTRANS-RXN}} |
Latest revision as of 14:18, 15 January 2021
Contents
Metabolite APS
- common name:
- adenosine 5'-phosphosulfate
- inchi key:
- InChIKey=IRLPACMLTUPBCL-KQYNXXCUSA-L
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O
- molecular weight:
- 425.266
- Synonym(s):
- adenylyl-sulfate
- APS
- adenosine phosphosulfate
- adenosine 5'-sulphatophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- METABOLIGHTS : MTBLC58243
- LIGAND-CPD:
- CAS : 485-84-7
- BIGG : aps
- HMDB : HMDB01003
- CHEBI:
Property "Smiles" (as page type) with input value "C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OS(=O)([O-])=O)([O-])=O" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
