Difference between revisions of "CPD-35"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-814-24-TRIENOL 44-DIMETHYL-CHOLESTA-814-24-TRIENOL] == * common name: ** 4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] == * common name: ** 4-acetamidobutanoate * inchi key: ** InChIKey=UZTFMUBKZQVKL...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] == |
* common name: | * common name: | ||
| − | ** | + | ** 4-acetamidobutanoate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(=O)NCCCC(=O)[O-] |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 144.15 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N-acetyl-4-aminobutyrate |
| − | + | ** N-acetyl-γ-aminobutyrate | |
| − | ** | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-37]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC11951 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02946 C02946] | ||
| + | * GO-TERMS : (REFMET "4-Acetamidobutanoic acid" NIL midford 3701443689 NIL NIL) | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5360158.html 5360158] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991994 6991994] |
| − | * HMDB : | + | * HMDB : HMDB03681 |
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11951 11951] |
| − | {{#set: common name=4 | + | {{#set: common name=4-acetamidobutanoate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M}} |
| − | {{#set: smiles=CC( | + | {{#set: smiles=CC(=O)NCCCC(=O)[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=144.15 }} |
| − | {{#set: common name= | + | {{#set: common name=N-acetyl-4-aminobutyrate|N-acetyl-γ-aminobutyrate}} |
| − | {{#set: produced by= | + | {{#set: produced by=RXN-37}} |
Latest revision as of 14:20, 15 January 2021
Contents
Metabolite CPD-35
- common name:
- 4-acetamidobutanoate
- inchi key:
- InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M
- smiles:
- CC(=O)NCCCC(=O)[O-]
- molecular weight:
- 144.15
- Synonym(s):
- N-acetyl-4-aminobutyrate
- N-acetyl-γ-aminobutyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC11951
- LIGAND-CPD:
- GO-TERMS : (REFMET "4-Acetamidobutanoic acid" NIL midford 3701443689 NIL NIL)
- CHEMSPIDER:
- PUBCHEM:
- HMDB : HMDB03681
- CHEBI:
Property "Smiles" (as page type) with input value "CC(=O)NCCCC(=O)[O-" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
