Difference between revisions of "CPD-20494"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * common name: ** α-D-glucose 6-phosphate * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20494 CPD-20494] == * common name: ** tamarixetin * inchi key: ** InChIKey=FPLMIPQZHHQWHN-U...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20494 CPD-20494] == |
* common name: | * common name: | ||
− | ** | + | ** tamarixetin |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FPLMIPQZHHQWHN-UHFFFAOYSA-N |
* smiles: | * smiles: | ||
− | ** C( | + | ** COC1(=CC=C(C=C(O)1)C3(OC2(C(=C(O)C=C(O)C=2)C(=O)C(O)=3))) |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 316.267 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4'-methoxy-3,3',5,7-tetrahydroxyflavone |
− | ** | + | ** 4'-methoxyquercetin |
+ | ** quercetin 4'-methyl ether | ||
+ | ** 3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-benzopyrone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN66-589]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C10188 C10188] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67492 67492] |
− | + | {{#set: common name=tamarixetin}} | |
− | + | {{#set: inchi key=InChIKey=FPLMIPQZHHQWHN-UHFFFAOYSA-N}} | |
− | + | {{#set: smiles=COC1(=CC=C(C=C(O)1)C3(OC2(C(=C(O)C=C(O)C=2)C(=O)C(O)=3)))}} | |
− | + | {{#set: molecular weight=316.267 }} | |
− | {{#set: common name= | + | {{#set: common name=4'-methoxy-3,3',5,7-tetrahydroxyflavone|4'-methoxyquercetin|quercetin 4'-methyl ether|3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-benzopyrone}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN66-589}} |
− | {{#set: smiles=C( | ||
− | {{#set: molecular weight= | ||
− | {{#set: common name= | ||
− | {{#set: |
Latest revision as of 14:20, 15 January 2021
Contents
Metabolite CPD-20494
- common name:
- tamarixetin
- inchi key:
- InChIKey=FPLMIPQZHHQWHN-UHFFFAOYSA-N
- smiles:
- COC1(=CC=C(C=C(O)1)C3(OC2(C(=C(O)C=C(O)C=2)C(=O)C(O)=3)))
- molecular weight:
- 316.267
- Synonym(s):
- 4'-methoxy-3,3',5,7-tetrahydroxyflavone
- 4'-methoxyquercetin
- quercetin 4'-methyl ether
- 3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-benzopyrone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links