Difference between revisions of "23-DIPHOSPHOGLYCERATE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OBTUSIFOLIOL OBTUSIFOLIOL] == * common name: ** obtusifoliol * inchi key: ** InChIKey=MMNYKQIDR...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common name: ** 2,3-diphospho-D-glycerate * i...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == |
* common name: | * common name: | ||
| − | ** | + | ** 2,3-diphospho-D-glycerate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-] |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 260.998 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2,3-bisphosphoglycerate |
| − | ** | + | ** D-Greenwald ester |
| + | ** 2,3-P2-D-glycerate | ||
| + | ** 2,3-bisphospho-D-glycerate | ||
| + | ** 2,3-diphosphoglycerate | ||
| + | ** DPG | ||
| + | ** 2,3-bisPGA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15509]] | ||
| + | * [[RXN-15511]] | ||
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15512]] | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC58248 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01159 C01159] | ||
| + | * GO-TERMS : (REFMET "2,3-Diphosphoglyceric acid" NIL midford 3701443689 NIL NIL) | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200383 25200383] |
| − | * HMDB : | + | * HMDB : HMDB01294 |
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58248 58248] |
| − | {{#set: common name= | + | {{#set: common name=2,3-diphospho-D-glycerate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I}} |
| − | {{#set: smiles= | + | {{#set: smiles=C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=260.998 }} |
| − | {{#set: common name= | + | {{#set: common name=2,3-bisphosphoglycerate|D-Greenwald ester|2,3-P2-D-glycerate|2,3-bisphospho-D-glycerate|2,3-diphosphoglycerate|DPG|2,3-bisPGA}} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-15509|RXN-15511|RXN-15510|RXN-15512}} |
Latest revision as of 14:18, 15 January 2021
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- common name:
- 2,3-diphospho-D-glycerate
- inchi key:
- InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I
- smiles:
- C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]
- molecular weight:
- 260.998
- Synonym(s):
- 2,3-bisphosphoglycerate
- D-Greenwald ester
- 2,3-P2-D-glycerate
- 2,3-bisphospho-D-glycerate
- 2,3-diphosphoglycerate
- DPG
- 2,3-bisPGA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58248
- LIGAND-CPD:
- GO-TERMS : (REFMET "2,3-Diphosphoglyceric acid" NIL midford 3701443689 NIL NIL)
- PUBCHEM:
- HMDB : HMDB01294
- CHEBI:
Property "Smiles" (as page type) with input value "C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
