Difference between revisions of "1-Alkenylglycerophosphoethanolamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] == * common name: ** pyridoxal 5'-phosphate * inchi ke...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkenylglycerophosphoethanolamines 1-Alkenylglycerophosphoethanolamines] == * common name: **...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkenylglycerophosphoethanolamines 1-Alkenylglycerophosphoethanolamines] ==
 
* common name:
 
* common name:
−
** pyridoxal 5'-phosphate
+
** a 1-O-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine
−
* inchi key:
 
−
** InChIKey=NGVDGCNFYWLIFO-UHFFFAOYSA-L
 
−
* smiles:
 
−
** CC1(N=CC(=C(C=1O)C=O)COP(=O)([O-])[O-])
 
−
* molecular weight:
 
−
** 245.128   
 
 
* Synonym(s):
 
* Synonym(s):
−
** PLP
+
** a 1-alkenylglycerophosphoethanolamine
−
** pyridoxal phosphate
 
−
** pyridoxal-5P
 
−
** pyridoxal 5-phosphate
 
−
** pyridoxal-P
 
−
** vitamin B6
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12590]]
+
* [[RXN-17735]]
−
* [[RXN-11322]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 1-O-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644168 644168]
+
{{#set: common name=a 1-alkenylglycerophosphoethanolamine}}
−
* METABOLIGHTS : MTBLC597326
+
{{#set: produced by=RXN-17735}}
−
* LIGAND-CPD:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?C00018 C00018]
 
−
* CHEBI:
 
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=597326 597326]
 
−
* GO-TERMS : (REFMET "Pyridoxal 5'-phosphate" NIL midford 3701443689 NIL NIL)
 
−
* CAS : 54-47-7
 
−
* BIGG : pydx5p
 
−
* HMDB : HMDB01491
 
−
* CHEMSPIDER:
 
−
** [http://www.chemspider.com/Chemical-Structure.559203.html 559203]
 
−
{{#set: common name=pyridoxal 5'-phosphate}}
 
−
{{#set: inchi key=InChIKey=NGVDGCNFYWLIFO-UHFFFAOYSA-L}}
 
−
{{#set: smiles=CC1(N=CC(=C(C=1O)C=O)COP(=O)([O-])[O-])}}
 
−
{{#set: molecular weight=245.128    }}
 
−
{{#set: common name=PLP|pyridoxal phosphate|pyridoxal-5P|pyridoxal 5-phosphate|pyridoxal-P|vitamin B6}}
 
−
{{#set: produced by=RXN-12590|RXN-11322}}
 

Latest revision as of 14:18, 15 January 2021

Metabolite 1-Alkenylglycerophosphoethanolamines

  • common name:
    • a 1-O-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine
  • Synonym(s):
    • a 1-alkenylglycerophosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=1-Alkenylglycerophosphoethanolamines&oldid=7273"