Difference between revisions of "3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] == * common name: ** N2-form...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] == * common name: ** 3...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] == |
* common name: | * common name: | ||
− | ** | + | ** 3-deoxy-D-arabino-heptulosonate 7-phosphate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-] |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 285.124 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-deoxy-D-arabino-heptulosonate-7-P |
− | ** | + | ** 3-deoxy-arabino-heptulosonate 7-phosphate |
− | ** | + | ** 3-deoxy-arabino-heptulosonate-7-P |
− | ** | + | ** 2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate |
− | ** | + | ** 3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate |
− | ** | + | ** 3-deoxy-arabino-heptulonate 7-phosphate |
+ | ** DAHP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3-DEHYDROQUINATE-SYNTHASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[DAHPSYN-RXN]] |
== External links == | == External links == | ||
+ | * BIGG : 2dda7p | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460215 5460215] |
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04691 C04691] |
− | * | + | * CAS : 2627-73-8 |
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58394 58394] |
− | {{#set: common name= | + | {{#set: common name=3-deoxy-D-arabino-heptulosonate 7-phosphate}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K}} |
− | {{#set: smiles=C( | + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-]}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=285.124 }} |
− | {{#set: common name= | + | {{#set: common name=3-deoxy-D-arabino-heptulosonate-7-P|3-deoxy-arabino-heptulosonate 7-phosphate|3-deoxy-arabino-heptulosonate-7-P|2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate|3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate|3-deoxy-arabino-heptulonate 7-phosphate|DAHP}} |
− | {{#set: consumed by= | + | {{#set: consumed by=3-DEHYDROQUINATE-SYNTHASE-RXN}} |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=DAHPSYN-RXN}} |
Latest revision as of 14:19, 15 January 2021
Contents
Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P
- common name:
- 3-deoxy-D-arabino-heptulosonate 7-phosphate
- inchi key:
- InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K
- smiles:
- C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-]
- molecular weight:
- 285.124
- Synonym(s):
- 3-deoxy-D-arabino-heptulosonate-7-P
- 3-deoxy-arabino-heptulosonate 7-phosphate
- 3-deoxy-arabino-heptulosonate-7-P
- 2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate
- 3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate
- 3-deoxy-arabino-heptulonate 7-phosphate
- DAHP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
Property "Smiles" (as page type) with input value "C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.