Difference between revisions of "T2-DECENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-decanoyl-ACPs 3-oxo-decanoyl-ACPs] == * common name: ** a 3-oxo-decanoyl-[acp] * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-DECENOYL-COA T2-DECENOYL-COA] == * common name: ** (2E)-dec-2-enoyl-CoA * inchi key: ** InCh...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-DECENOYL-COA T2-DECENOYL-COA] == |
* common name: | * common name: | ||
| − | ** | + | ** (2E)-dec-2-enoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=MGNBGCRQQFMNBM-YJHHLLFWSA-J | ||
| + | * smiles: | ||
| + | ** CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 915.738 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2E-decenoyl-CoA |
| − | ** | + | ** 2-trans-decenoyl-CoA |
| + | ** trans-Δ2-decenoyl-CoA | ||
| + | ** trans-dec-2-enoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13616]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13615]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50909850 50909850] |
| − | {{#set: consumed by=RXN- | + | * METABOLIGHTS : MTBLC61406 |
| − | {{#set: produced by=RXN- | + | * HMDB : HMDB03948 |
| + | * BIGG : dc2coa | ||
| + | * REFMET : 2E-decenoyl-CoA | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05275 C05275] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61406 61406] | ||
| + | {{#set: common name=(2E)-dec-2-enoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=MGNBGCRQQFMNBM-YJHHLLFWSA-J}} | ||
| + | {{#set: smiles=CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: molecular weight=915.738 }} | ||
| + | {{#set: common name=2E-decenoyl-CoA|2-trans-decenoyl-CoA|trans-Δ2-decenoyl-CoA|trans-dec-2-enoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-13616}} | ||
| + | {{#set: produced by=RXN-13615}} | ||
Latest revision as of 14:19, 15 January 2021
Contents
Metabolite T2-DECENOYL-COA
- common name:
- (2E)-dec-2-enoyl-CoA
- inchi key:
- InChIKey=MGNBGCRQQFMNBM-YJHHLLFWSA-J
- smiles:
- CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 915.738
- Synonym(s):
- 2E-decenoyl-CoA
- 2-trans-decenoyl-CoA
- trans-Δ2-decenoyl-CoA
- trans-dec-2-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- METABOLIGHTS : MTBLC61406
- HMDB : HMDB03948
- BIGG : dc2coa
- REFMET : 2E-decenoyl-CoA
- LIGAND-CPD:
- CHEBI:
Property "Smiles" (as page type) with input value "CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
