Difference between revisions of "2-METHYLMALEATE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYPHENYLGLYCOLALDEHYDE DIHYDROXYPHENYLGLYCOLALDEHYDE] == * common name: ** 3,4-dihydroxy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYLMALEATE 2-METHYLMALEATE] == * common name: ** citraconate * inchi key: ** InChIKey=HNEG...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYLMALEATE 2-METHYLMALEATE] == |
* common name: | * common name: | ||
| − | ** | + | ** citraconate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HNEGQIOMVPPMNR-IHWYPQMZSA-L |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CC(=O)[O-])C(=O)[O-] |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 128.084 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-methylmaleate |
| − | ** | + | ** citraconic acid |
| − | + | ** methylmaleic acid | |
| − | |||
| − | |||
| − | ** | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[R-2-METHYLMALATE-DEHYDRATASE-RXN]] | ||
== External links == | == External links == | ||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02226 C02226] |
| − | * | + | * DRUGBANK : DB04734 |
| − | ** | + | * GO-TERMS : (REFMET "Citraconic acid" NIL midford 3701443689 NIL NIL) |
| + | * CAS : 498-23-7 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461090 5461090] |
| − | * HMDB : | + | * HMDB : HMDB00634 |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30719 30719] |
| − | {{#set: common name= | + | {{#set: common name=citraconate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=HNEGQIOMVPPMNR-IHWYPQMZSA-L}} |
| − | {{#set: smiles= | + | {{#set: smiles=CC(=CC(=O)[O-])C(=O)[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=128.084 }} |
| − | {{#set: common name= | + | {{#set: common name=2-methylmaleate|citraconic acid|methylmaleic acid}} |
| − | {{#set: | + | {{#set: reversible reaction associated=R-2-METHYLMALATE-DEHYDRATASE-RXN}} |
Latest revision as of 14:19, 15 January 2021
Contents
Metabolite 2-METHYLMALEATE
- common name:
- citraconate
- inchi key:
- InChIKey=HNEGQIOMVPPMNR-IHWYPQMZSA-L
- smiles:
- CC(=CC(=O)[O-])C(=O)[O-]
- molecular weight:
- 128.084
- Synonym(s):
- 2-methylmaleate
- citraconic acid
- methylmaleic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
- DRUGBANK : DB04734
- GO-TERMS : (REFMET "Citraconic acid" NIL midford 3701443689 NIL NIL)
- CAS : 498-23-7
- PUBCHEM:
- HMDB : HMDB00634
- CHEBI:
Property "Smiles" (as page type) with input value "CC(=CC(=O)[O-])C(=O)[O-" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
