Difference between revisions of "5-METHYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * common name: ** 2-(α-hydroxyeth...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF-GLU-N 5-METHYL-THF-GLU-N] == * common name: ** a 5-methyltetrahydrofolate * Synony...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF-GLU-N 5-METHYL-THF-GLU-N] ==
 
* common name:
 
* common name:
−
** 2-(α-hydroxyethyl)thiamine diphosphate
+
** a 5-methyltetrahydrofolate
−
* inchi key:
 
−
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
 
−
* smiles:
 
−
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
 
−
* molecular weight:
 
−
** 466.341   
 
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(α-hydroxyethyl)-TPP
+
** an N5-methyltetrahydrofolate
−
** 2-(α-hydroxyethyl)-ThPP
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12508]]
+
* [[HOMOCYSMETB12-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12583]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 5-methyltetrahydrofolate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
+
{{#set: common name=an N5-methyltetrahydrofolate}}
−
* CHEBI:
+
{{#set: consumed by=HOMOCYSMETB12-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
 
−
{{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}}
 
−
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
 
−
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
 
−
{{#set: molecular weight=466.341    }}
 
−
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}}
 
−
{{#set: consumed by=RXN-12508}}
 
−
{{#set: produced by=RXN-12583}}
 

Latest revision as of 14:19, 15 January 2021

Metabolite 5-METHYL-THF-GLU-N

  • common name:
    • a 5-methyltetrahydrofolate
  • Synonym(s):
    • an N5-methyltetrahydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=5-METHYL-THF-GLU-N&oldid=7697"