Difference between revisions of "2-Octenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * common name: ** apigenin * inchi key: ** InChIKey=KZNIFHPLKGYRTM-UHFFFAOY...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Octenoyl-ACPs 2-Octenoyl-ACPs] == * common name: ** a trans oct-2-enoyl-[acp] * Synonym(s): *...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Octenoyl-ACPs 2-Octenoyl-ACPs] ==
 
* common name:
 
* common name:
−
** apigenin
+
** a trans oct-2-enoyl-[acp]
−
* inchi key:
 
−
** InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M
 
−
* smiles:
 
−
** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))
 
−
* molecular weight:
 
−
** 269.233   
 
 
* Synonym(s):
 
* Synonym(s):
−
** 4',5,7-trihydroxyflavone
+
** a trans-oct-2-enoyl-[acp]
 +
** a trans-oct-2-enoyl-[acyl-carrier protein]
 +
** (2E)-octenoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN66-587]]
+
* [[RXN-9526]]
 +
* [[RXN-9659]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[4.2.1.59-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* HMDB : HMDB02124
+
{{#set: common name=a trans oct-2-enoyl-[acp]}}
−
* LIPID_MAPS : LMPK12110005
+
{{#set: common name=a trans-oct-2-enoyl-[acp]|a trans-oct-2-enoyl-[acyl-carrier protein]|(2E)-octenoyl-[acp]}}
−
* CAS : 520-36-5
+
{{#set: consumed by=RXN-9526|RXN-9659}}
−
* PUBCHEM:
+
{{#set: produced by=4.2.1.59-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200950 25200950]
 
−
* REFMET : Apigenin
 
−
* LIGAND-CPD:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?C01477 C01477]
 
−
* CHEBI:
 
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58470 58470]
 
−
{{#set: common name=apigenin}}
 
−
{{#set: inchi key=InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M}}
 
−
{{#set: smiles=C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))}}
 
−
{{#set: molecular weight=269.233    }}
 
−
{{#set: common name=4',5,7-trihydroxyflavone}}
 
−
{{#set: consumed by=RXN66-587}}
 

Latest revision as of 14:19, 15 January 2021

Metabolite 2-Octenoyl-ACPs

  • common name:
    • a trans oct-2-enoyl-[acp]
  • Synonym(s):
    • a trans-oct-2-enoyl-[acp]
    • a trans-oct-2-enoyl-[acyl-carrier protein]
    • (2E)-octenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Property "Common name" (as page type) with input value "a trans oct-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

  • Property "Common name" (as page type) with input value "a trans-oct-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
  • Property "Common name" (as page type) with input value "a trans-oct-2-enoyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
  • Property "Common name" (as page type) with input value "(2E)-octenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=2-Octenoyl-ACPs&oldid=7732"