Difference between revisions of "Curation"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ubiquinones == * common-name: ** a ubiquinone == Reaction(s) known to consume the compound == * 1.10.2.2-RXN * 1.5.5.1-RXN * NA...") |
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * common-name: ** thiamine d...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THIAMINE-PYROPHOSPHATE == |
| + | * smiles: | ||
| + | ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** thiamine diphosphate |
| + | * inchi-key: | ||
| + | ** ayekofbpnlcajy-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 422.288 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12583]] |
| − | + | * [[RXN0-3542]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN0- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12508]] |
| − | * [[ | + | * [[RXN0-3542]] |
| − | * [[ | + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiamine diphosphate}} |
| + | {{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=422.288}} | ||
Revision as of 16:28, 6 January 2021
Contents
Metabolite THIAMINE-PYROPHOSPHATE
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- common-name:
- thiamine diphosphate
- inchi-key:
- ayekofbpnlcajy-uhfffaoysa-l
- molecular-weight:
- 422.288
