Difference between revisions of "Category:Organism"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-4-PHOSPHATE == * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * common-name: ** 1d-myo-inositol 4-monophosphate...") |
(Created page with "Category:metabolite == Metabolite apo-ACP == * common-name: ** an apo-[acyl-carrier protein] == Reaction(s) known to consume the compound == * HOLO-ACP-SYNTH-RXN == Re...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite apo-ACP == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** an apo-[acyl-carrier protein] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[HOLO-ACP-SYNTH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[3.1. | + | * [[3.1.4.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an apo-[acyl-carrier protein]}} |
| − | |||
| − | |||
Revision as of 16:28, 6 January 2021
Contents
Metabolite apo-ACP
- common-name:
- an apo-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an apo-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
Pages in category "Organism"
This category contains only the following page.
