Difference between revisions of "Curation"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * common-name: ** thiamine d...")
(Created page with "Category:metabolite == Metabolite apo-Transcarboxylases == * common-name: ** an apo-[methylmalonyl-coa:pyruvate carboxytransferase] == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE-PYROPHOSPHATE ==
+
== Metabolite apo-Transcarboxylases ==
* smiles:
 
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 
 
* common-name:
 
* common-name:
** thiamine diphosphate
+
** an apo-[methylmalonyl-coa:pyruvate carboxytransferase]
* inchi-key:
 
** ayekofbpnlcajy-uhfffaoysa-l
 
* molecular-weight:
 
** 422.288
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12583]]
+
* [[6.3.4.9-RXN]]
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12508]]
 
* [[RXN0-3542]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine diphosphate}}
+
{{#set: common-name=an apo-[methylmalonyl-coa:pyruvate carboxytransferase]}}
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
 
{{#set: molecular-weight=422.288}}
 

Revision as of 12:11, 12 January 2021

Metabolite apo-Transcarboxylases

  • common-name:
    • an apo-[methylmalonyl-coa:pyruvate carboxytransferase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[methylmalonyl-coa:pyruvate carboxytransferase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.