Difference between revisions of "Curation"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * common-name: ** thiamine d...") |
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * smiles: ** cc(=o)c(c)(o)c(=o)[o-] * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-ACETO-LACTATE == |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)c(c)(o)c(=o)[o-] |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-2-acetolactate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nmdwgegfjubklb-yfkpbyrvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 131.108 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[ACETOLACTREDUCTOISOM-RXN]] |
| − | * [[ | + | * [[RXN-6081]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ACETOLACTREDUCTOISOM-RXN]] |
| − | + | * [[ACETOLACTSYN-RXN]] | |
| − | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-2-acetolactate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=131.108}} |
Revision as of 18:42, 12 January 2021
Contents
Metabolite 2-ACETO-LACTATE
- smiles:
- cc(=o)c(c)(o)c(=o)[o-]
- common-name:
- (s)-2-acetolactate
- inchi-key:
- nmdwgegfjubklb-yfkpbyrvsa-m
- molecular-weight:
- 131.108
