Difference between revisions of "Category:Metabolite"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7414 == * smiles: ** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2) * common-name: ** ε-caro...")
(Created page with "Category:metabolite == Metabolite COUMARALDEHYDE == * smiles: ** c(=o)c=cc1(c=cc(o)=cc=1) * common-name: ** 4-coumaraldehyde * inchi-key: ** cjxmvkynvigqbs-owojbtedsa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7414 ==
+
== Metabolite COUMARALDEHYDE ==
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2)
+
** c(=o)c=cc1(c=cc(o)=cc=1)
 
* common-name:
 
* common-name:
** ε-carotene
+
** 4-coumaraldehyde
 
* inchi-key:
 
* inchi-key:
** qabfxomooywzlz-gdbzimipsa-n
+
** cjxmvkynvigqbs-owojbtedsa-n
 
* molecular-weight:
 
* molecular-weight:
** 536.882
+
** 148.161
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-1102]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8028]]
+
* [[RXN-1101]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ε-carotene}}
+
{{#set: common-name=4-coumaraldehyde}}
{{#set: inchi-key=inchikey=qabfxomooywzlz-gdbzimipsa-n}}
+
{{#set: inchi-key=inchikey=cjxmvkynvigqbs-owojbtedsa-n}}
{{#set: molecular-weight=536.882}}
+
{{#set: molecular-weight=148.161}}

Revision as of 15:34, 13 January 2021

Metabolite COUMARALDEHYDE

  • smiles:
    • c(=o)c=cc1(c=cc(o)=cc=1)
  • common-name:
    • 4-coumaraldehyde
  • inchi-key:
    • cjxmvkynvigqbs-owojbtedsa-n
  • molecular-weight:
    • 148.161

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Pages in category "Metabolite"

The following 200 pages are in this category, out of 2,140 total.

(previous page) (next page)
(previous page) (next page)