Difference between revisions of "Category:Organism"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-GLYCEROL == * common-name: ** an l-1-phosphatidyl-sn-glycerol == Reaction(s) known to consume the compound == == Reactio...") |
(Created page with "Category:metabolite == Metabolite CPD-7414 == * smiles: ** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2) * common-name: ** ε-caro...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7414 == |
| + | * smiles: | ||
| + | ** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** ε-carotene |
| + | * inchi-key: | ||
| + | ** qabfxomooywzlz-gdbzimipsa-n | ||
| + | * molecular-weight: | ||
| + | ** 536.882 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8028]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ε-carotene}} |
| + | {{#set: inchi-key=inchikey=qabfxomooywzlz-gdbzimipsa-n}} | ||
| + | {{#set: molecular-weight=536.882}} | ||
Revision as of 15:34, 13 January 2021
Contents
Metabolite CPD-7414
- smiles:
- cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2)
- common-name:
- ε-carotene
- inchi-key:
- qabfxomooywzlz-gdbzimipsa-n
- molecular-weight:
- 536.882
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Pages in category "Organism"
This category contains only the following page.
