Difference between revisions of "Curation"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * common-name: ** thiamine d...") |
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * common-name: ** l-citrulline * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-CITRULLINE == |
* smiles: | * smiles: | ||
− | ** | + | ** c(nc(n)=o)ccc([n+])c(=o)[o-] |
* common-name: | * common-name: | ||
− | ** | + | ** l-citrulline |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rhgklrlohdjjdr-bypyzucnsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 175.187 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ARGSUCCINSYN-RXN]] |
− | * [[ | + | * [[ORNCARBAMTRANSFER-RXN]] |
+ | * [[RXN-13482]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[ORNCARBAMTRANSFER-RXN]] |
− | * [[ | + | * [[RXN-13482]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-citrulline}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=175.187}} |
Revision as of 16:56, 13 January 2021
Contents
Metabolite L-CITRULLINE
- smiles:
- c(nc(n)=o)ccc([n+])c(=o)[o-]
- common-name:
- l-citrulline
- inchi-key:
- rhgklrlohdjjdr-bypyzucnsa-n
- molecular-weight:
- 175.187