Difference between revisions of "Category:Organism"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7414 == * smiles: ** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2) * common-name: ** ε-caro...") |
(Created page with "Category:metabolite == Metabolite CPD-13912 == * smiles: ** c(c(c(o)c(c([o-])=o)(c([o-])=o)o)o)o * common-name: ** 2-carboxy-l-threo-pentonate * inchi-key: ** cqirjdzgdxtx...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13912 == |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(c(o)c(c([o-])=o)(c([o-])=o)o)o)o |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-carboxy-l-threo-pentonate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cqirjdzgdxtxkf-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 208.124 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12871]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-carboxy-l-threo-pentonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqirjdzgdxtxkf-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=208.124}} |
Revision as of 16:56, 13 January 2021
Contents
Metabolite CPD-13912
- smiles:
- c(c(c(o)c(c([o-])=o)(c([o-])=o)o)o)o
- common-name:
- 2-carboxy-l-threo-pentonate
- inchi-key:
- cqirjdzgdxtxkf-uhfffaoysa-l
- molecular-weight:
- 208.124
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Pages in category "Organism"
This category contains only the following page.
