Difference between revisions of "Curation"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * common-name: ** l-citrulline * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite apo-Transcarboxylases == * common-name: ** an apo-[methylmalonyl-coa:pyruvate carboxytransferase] == Reaction(s) known to consume the com...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite apo-Transcarboxylases == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** an apo-[methylmalonyl-coa:pyruvate carboxytransferase] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[6.3.4.9-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an apo-[methylmalonyl-coa:pyruvate carboxytransferase]}} |
− | |||
− |
Revision as of 09:25, 14 January 2021
Contents
Metabolite apo-Transcarboxylases
- common-name:
- an apo-[methylmalonyl-coa:pyruvate carboxytransferase]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an apo-[methylmalonyl-coa:pyruvate carboxytransferase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.