Difference between revisions of "Category:Metabolite"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite G3P == * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * common-name: ** 3-phospho-d-glycerate * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...")
(Created page with "Category:metabolite == Metabolite INDOLE == * smiles: ** c2(c=cc1(=c(c=cn1)c=2)) * common-name: ** indole * inchi-key: ** sikjaqjrhwyjai-uhfffaoysa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite G3P ==
+
== Metabolite INDOLE ==
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
+
** c2(c=cc1(=c(c=cn1)c=2))
 
* common-name:
 
* common-name:
** 3-phospho-d-glycerate
+
** indole
 
* inchi-key:
 
* inchi-key:
** osjppgntcrnqqc-uwtatzphsa-k
+
** sikjaqjrhwyjai-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 183.034
+
** 117.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-PHOSPHOGLYCERATE-PHOSPHATASE-RXN]]
+
* [[INDOLE-23-DIOXYGENASE-RXN]]
* [[3PGAREARR-RXN]]
+
* [[RXN0-2381]]
* [[PGLYCDEHYDROG-RXN]]
+
* [[RXN0-2382]]
* [[PHOSGLYPHOS-RXN]]
 
* [[RXN-15511]]
 
* [[RXN-15513]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3PGAREARR-RXN]]
+
* [[RXN0-2381]]
* [[GLY3KIN-RXN]]
 
* [[PGLYCDEHYDROG-RXN]]
 
* [[PHOSGLYPHOS-RXN]]
 
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
 
* [[RXN-15511]]
 
* [[RXN-15513]]
 
* [[RXN-961]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phospho-d-glycerate}}
+
{{#set: common-name=indole}}
{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
+
{{#set: inchi-key=inchikey=sikjaqjrhwyjai-uhfffaoysa-n}}
{{#set: molecular-weight=183.034}}
+
{{#set: molecular-weight=117.15}}

Revision as of 20:27, 17 March 2021

Metabolite INDOLE

  • smiles:
    • c2(c=cc1(=c(c=cn1)c=2))
  • common-name:
    • indole
  • inchi-key:
    • sikjaqjrhwyjai-uhfffaoysa-n
  • molecular-weight:
    • 117.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Pages in category "Metabolite"

The following 200 pages are in this category, out of 2,140 total.

(previous page) (next page)
(previous page) (next page)