Difference between revisions of "Category:Organism"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13912 == * smiles: ** c(c(c(o)c(c([o-])=o)(c([o-])=o)o)o)o * common-name: ** 2-carboxy-l-threo-pentonate * inchi-key: ** cqirjdzgdxtx...") |
(Created page with "{{#ask: Category:organism | ?nb reaction associated | ?nb gene associated | ?nb pathway associated |sort=nb reaction associated |order=descending }}") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | {{#ask: [[Category:organism]] |
− | + | | ?nb reaction associated | |
− | + | | ?nb gene associated | |
− | + | | ?nb pathway associated | |
− | + | |sort=nb reaction associated | |
− | + | |order=descending | |
− | + | }} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 09:01, 18 March 2021
Pages in category "Organism"
This category contains only the following page.