Difference between revisions of "RXN0-4261"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-BUTYRYL-COA == * smiles: ** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)...")
 
(Created page with "Category:reaction == Reaction RXN0-4261 == * direction: ** left-to-right * common-name: ** helicase ** helicase domain == Reaction formula == * 1 ATP[c] '''+''' 1 Su...")
 
(10 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite 2-METHYL-BUTYRYL-COA ==
+
== Reaction RXN0-4261 ==
* smiles:
+
* direction:
** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** left-to-right
 
* common-name:
 
* common-name:
** 2-methylbutanoyl-coa
+
** helicase
* inchi-key:
+
** helicase domain
** lynvnydeqmmnmz-xgxnyeovsa-j
+
== Reaction formula ==
* molecular-weight:
+
* 1 [[ATP]][c] '''+''' 1 [[Supercoiled-Duplex-DNAs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[Single-Stranded-DNAs]][c]
** 847.62
+
== Gene(s) associated with this reaction  ==
== Reaction(s) known to consume the compound ==
+
* Gene: [[Ec-18_003980]]
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
+
** Category: [[annotation]]
* [[2KETO-3METHYLVALERATE-RXN]]
+
*** Source: [[esiliculosus_genome]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
* [[MBCOA-DHLIPOAMIDE-RXN]]
+
* Gene: [[Ec-02_002310]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
+
*** Source: [[esiliculosus_genome]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
* [[2KETO-3METHYLVALERATE-RXN]]
+
== Pathway(s) ==
* [[MBCOA-DHLIPOAMIDE-RXN]]
+
== Reconstruction information  ==
== Reaction(s) of unknown directionality ==
+
* category: [[annotation]]; source: [[esiliculosus_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=2-methylbutanoyl-coa}}
+
== External links  ==
{{#set: inchi-key=inchikey=lynvnydeqmmnmz-xgxnyeovsa-j}}
+
* METANETX-RXN : MNXR123180
{{#set: molecular-weight=847.62}}
+
{{#set: direction=left-to-right}}
 +
{{#set: common-name=helicase domain|helicase}}
 +
{{#set: nb gene associated=2}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=esiliculosus_genome}}

Latest revision as of 09:01, 18 March 2021

Reaction RXN0-4261

  • direction:
    • left-to-right
  • common-name:
    • helicase
    • helicase domain

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links

  • METANETX-RXN : MNXR123180