Difference between revisions of "Manual"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite COUMARALDEHYDE == * smiles: ** c(=o)c=cc1(c=cc(o)=cc=1) * common-name: ** 4-coumaraldehyde * inchi-key: ** cjxmvkynvigqbs-owojbtedsa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD-7414 == * smiles: ** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2) * common-name: ** ε-caro...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7414 == |
* smiles: | * smiles: | ||
− | ** c(= | + | ** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2) |
* common-name: | * common-name: | ||
− | ** | + | ** ε-carotene |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qabfxomooywzlz-gdbzimipsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 536.882 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8028]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ε-carotene}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qabfxomooywzlz-gdbzimipsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
Revision as of 20:27, 17 March 2021
Contents
Metabolite CPD-7414
- smiles:
- cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2)
- common-name:
- ε-carotene
- inchi-key:
- qabfxomooywzlz-gdbzimipsa-n
- molecular-weight:
- 536.882