Difference between revisions of "CPD-458"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12724 == * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) * common-name: ** baicalein * inchi-key: ** fxnfhkrtjbstcs...") |
(Created page with "Category:metabolite == Metabolite Charged-ALA-tRNAs == * common-name: ** an l-alanyl-[trnaala] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Charged-ALA-tRNAs == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** an l-alanyl-[trnaala] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ALANINE--TRNA-LIGASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-alanyl-[trnaala]}} |
| − | |||
| − | |||
Revision as of 16:22, 6 January 2021
Contents
Metabolite Charged-ALA-tRNAs
- common-name:
- an l-alanyl-[trnaala]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-alanyl-[trnaala" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
