Difference between revisions of "T2-C4-DECADIENYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14596 == * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * common-name: ** neolinustatin * inchi-key: ** wosy...") |
(Created page with "Category:metabolite == Metabolite CPD-5881 == * smiles: ** cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2)) * common-name: ** 4α-hydroxy-tetrahydrobiopterin * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-5881 == |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2)) |
* common-name: | * common-name: | ||
| − | ** | + | ** 4α-hydroxy-tetrahydrobiopterin |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kjkiefupappgbc-atdkunpgsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 257.249 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7908]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-569]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4α-hydroxy-tetrahydrobiopterin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kjkiefupappgbc-atdkunpgsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=257.249}} |
Revision as of 16:25, 6 January 2021
Contents
Metabolite CPD-5881
- smiles:
- cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2))
- common-name:
- 4α-hydroxy-tetrahydrobiopterin
- inchi-key:
- kjkiefupappgbc-atdkunpgsa-n
- molecular-weight:
- 257.249
