Difference between revisions of "DNA-Adjacent-Pyrimidines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * common-name: ** d-threo-isocitrate * inchi-key: ** odblhexud...") |
(Created page with "Category:metabolite == Metabolite CPD-13612 == * smiles: ** cccccccccccccccc(c(co)[n+])o * common-name: ** d-erythro-sphinganine * inchi-key: ** otkjdmgtuttymp-zwkotpchsa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13612 == |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccc(c(co)[n+])o |
* common-name: | * common-name: | ||
| − | ** d- | + | ** d-erythro-sphinganine |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** otkjdmgtuttymp-zwkotpchsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 302.519 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13733]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-13733]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=d- | + | {{#set: common-name=d-erythro-sphinganine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=otkjdmgtuttymp-zwkotpchsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=302.519}} |
Revision as of 12:05, 12 January 2021
Contents
Metabolite CPD-13612
- smiles:
- cccccccccccccccc(c(co)[n+])o
- common-name:
- d-erythro-sphinganine
- inchi-key:
- otkjdmgtuttymp-zwkotpchsa-o
- molecular-weight:
- 302.519
