Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * common-name: ** cis-aconitate * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...")
(Created page with "Category:metabolite == Metabolite Donor-H2 == * common-name: ** an reduced unknown electron acceptor == Reaction(s) known to consume the compound == * ADENYLYLSULFATE-RE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CIS-ACONITATE ==
+
== Metabolite Donor-H2 ==
* smiles:
 
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
 
* common-name:
 
* common-name:
** cis-aconitate
+
** an reduced unknown electron acceptor
* inchi-key:
 
** gtzcvfvgugfeme-iwqzzhsrsa-k
 
* molecular-weight:
 
** 171.086
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
* [[ACONITATEHYDR-RXN]]
+
* [[CHD-RXN]]
 +
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 +
* [[NADH-DEHYDROGENASE-RXN]]
 +
* [[R07063]]
 +
* [[R07861]]
 +
* [[RXN-10851]]
 +
* [[RXN-11334]]
 +
* [[RXN-12473]]
 +
* [[RXN-13445]]
 +
* [[RXN-13682]]
 +
* [[RXN-14480]]
 +
* [[RXN-8667]]
 +
* [[RXN0-2023]]
 +
* [[RXN0-5063]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
* [[ACONITATEHYDR-RXN]]
+
* [[CHD-RXN]]
 +
* [[NADH-DEHYDROGENASE-RXN]]
 +
* [[R07861]]
 +
* [[RXN-10851]]
 +
* [[RXN-10981]]
 +
* [[RXN-11334]]
 +
* [[RXN-13682]]
 +
* [[RXN-14480]]
 +
* [[RXN-14642]]
 +
* [[RXN-6081]]
 +
* [[THIOREDOXIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-aconitate}}
+
{{#set: common-name=an reduced unknown electron acceptor}}
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
 
{{#set: molecular-weight=171.086}}
 

Revision as of 12:05, 12 January 2021