Difference between revisions of "CPD-458"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-ALA-tRNAs == * common-name: ** an l-alanyl-[trnaala] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHOSPHORIBOSYL-ATP == |
| + | * smiles: | ||
| + | ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o | ||
* common-name: | * common-name: | ||
| − | ** | + | ** 1-(5-phospho-β-d-ribosyl)-atp |
| + | * inchi-key: | ||
| + | ** rknhjbvbfhdxgr-keohhstqsa-i | ||
| + | * molecular-weight: | ||
| + | ** 714.24 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ATPPHOSPHORIBOSYLTRANS-RXN]] | ||
| + | * [[HISTPRATPHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ATPPHOSPHORIBOSYLTRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}} |
| + | {{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}} | ||
| + | {{#set: molecular-weight=714.24}} | ||
Revision as of 12:06, 12 January 2021
Contents
Metabolite PHOSPHORIBOSYL-ATP
- smiles:
- c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
- common-name:
- 1-(5-phospho-β-d-ribosyl)-atp
- inchi-key:
- rknhjbvbfhdxgr-keohhstqsa-i
- molecular-weight:
- 714.24
