Difference between revisions of "Thiols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Long-Chain-Aldehydes == * common-name: ** a long-chain aldehyde == Reaction(s) known to consume the compound == * LONG-CHAIN-FATTY-ACYL...") |
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) * common-name: ** β-nicotinamid...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NICOTINAMIDE_NUCLEOTIDE == |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** β-nicotinamide d-ribonucleotide |
| + | * inchi-key: | ||
| + | ** dayljwodmcoqew-turqnecasa-m | ||
| + | * molecular-weight: | ||
| + | ** 333.214 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5841]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-nicotinamide d-ribonucleotide}} |
| + | {{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}} | ||
| + | {{#set: molecular-weight=333.214}} | ||
Revision as of 15:45, 12 January 2021
Contents
Metabolite NICOTINAMIDE_NUCLEOTIDE
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- common-name:
- β-nicotinamide d-ribonucleotide
- inchi-key:
- dayljwodmcoqew-turqnecasa-m
- molecular-weight:
- 333.214
